C26H23N5O7 — CID 6221404
5-[[4-[(Z)-C-methyl-N-[[4-[(5-methyl-3-nitropyrazol-1-yl)methyl]benzoyl]amino]carbonimidoyl]phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 6221404) has the molecular formula C26H23N5O7 and a molecular weight of 517.50 g/mol. Its IUPAC name is 5-[[4-[(Z)-C-methyl-N-[[4-[(5-methyl-3-nitropyrazol-1-yl)methyl]benzoyl]amino]carbonimidoyl]phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[(Z)-C-methyl-N-[[4-[(5-methyl-3-nitropyrazol-1-yl)methyl]benzoyl]amino]carbonimidoyl]phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 6221404 |
| Molecular Formula | C26H23N5O7 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 5-[[4-[(Z)-C-methyl-N-[[4-[(5-methyl-3-nitropyrazol-1-yl)methyl]benzoyl]amino]carbonimidoyl]phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | C/C(=N/NC(=O)c1ccc(Cn2nc([N+](=O)[O-])cc2C)cc1)c1ccc(OCc2ccc(C(=O)O)o2)cc1 |
| InChI | InChI=1S/C26H23N5O7/c1-16-13-24(31(35)36)29-30(16)14-18-3-5-20(6-4-18)25(32)28-27-17(2)19-7-9-21(10-8-19)37-15-22-11-12-23(38-22)26(33)34/h3-13H,14-15H2,1-2H3,(H,28,32)(H,33,34)/b27-17- |
| InChIKey | VJXPFOWECSPGDY-PKAZHMFMSA-N |
| XLogP | 4.17 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|