C20H19N5O7 — CID 6389187
5-[[4-[(Z)-C-methyl-N-[3-(4-nitropyrazol-1-yl)propanoylamino]carbonimidoyl]phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 6389187) has the molecular formula C20H19N5O7 and a molecular weight of 441.40 g/mol. Its IUPAC name is 5-[[4-[(Z)-C-methyl-N-[3-(4-nitropyrazol-1-yl)propanoylamino]carbonimidoyl]phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[(Z)-C-methyl-N-[3-(4-nitropyrazol-1-yl)propanoylamino]carbonimidoyl]phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 6389187 |
| Molecular Formula | C20H19N5O7 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 5-[[4-[(Z)-C-methyl-N-[3-(4-nitropyrazol-1-yl)propanoylamino]carbonimidoyl]phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | C/C(=N/NC(=O)CCn1cc([N+](=O)[O-])cn1)c1ccc(OCc2ccc(C(=O)O)o2)cc1 |
| InChI | InChI=1S/C20H19N5O7/c1-13(22-23-19(26)8-9-24-11-15(10-21-24)25(29)30)14-2-4-16(5-3-14)31-12-17-6-7-18(32-17)20(27)28/h2-7,10-11H,8-9,12H2,1H3,(H,23,26)(H,27,28)/b22-13- |
| InChIKey | MHTGVAZSKHOYEH-XKZIYDEJSA-N |
| XLogP | 2.59 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|