C10H10Cl3NO — CID 62225352
2-chloro-2-(3,5-dichlorophenyl)-N,N-dimethylacetamide (PubChem CID 62225352) has the molecular formula C10H10Cl3NO and a molecular weight of 266.56 g/mol. Its IUPAC name is 2-chloro-2-(3,5-dichlorophenyl)-N,N-dimethylacetamide.
| Compound Name | 2-chloro-2-(3,5-dichlorophenyl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 62225352 |
| Molecular Formula | C10H10Cl3NO |
| Molecular Weight | 266.56 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | 2-chloro-2-(3,5-dichlorophenyl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C(Cl)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H10Cl3NO/c1-14(2)10(15)9(13)6-3-7(11)5-8(12)4-6/h3-5,9H,1-2H3 |
| InChIKey | DYYFZGVIDXVQKO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|