C13H15FN4OS — CID 6223188
(2Z)-2-[(2-fluorophenyl)hydrazinylidene]-3-oxo-3-pyrrolidin-1-ylpropanethioamide (PubChem CID 6223188) has the molecular formula C13H15FN4OS and a molecular weight of 294.35 g/mol. Its IUPAC name is (2Z)-2-[(2-fluorophenyl)hydrazinylidene]-3-oxo-3-pyrrolidin-1-ylpropanethioamide.
| Compound Name | (2Z)-2-[(2-fluorophenyl)hydrazinylidene]-3-oxo-3-pyrrolidin-1-ylpropanethioamide |
|---|---|
| PubChem CID | 6223188 |
| Molecular Formula | C13H15FN4OS |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2Z)-2-[(2-fluorophenyl)hydrazinylidene]-3-oxo-3-pyrrolidin-1-ylpropanethioamide |
| SMILES | NC(=S)/C(=N\Nc1ccccc1F)C(=O)N1CCCC1 |
| InChI | InChI=1S/C13H15FN4OS/c14-9-5-1-2-6-10(9)16-17-11(12(15)20)13(19)18-7-3-4-8-18/h1-2,5-6,16H,3-4,7-8H2,(H2,15,20)/b17-11+ |
| InChIKey | NCHFEWLAFVTQRZ-GZTJUZNOSA-N |
| XLogP | 1.50 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|