C13H14Cl2N4OS — CID 6223236
(2Z)-2-[(2,5-dichlorophenyl)hydrazinylidene]-3-oxo-3-pyrrolidin-1-ylpropanethioamide (PubChem CID 6223236) has the molecular formula C13H14Cl2N4OS and a molecular weight of 345.26 g/mol. Its IUPAC name is (2Z)-2-[(2,5-dichlorophenyl)hydrazinylidene]-3-oxo-3-pyrrolidin-1-ylpropanethioamide.
| Compound Name | (2Z)-2-[(2,5-dichlorophenyl)hydrazinylidene]-3-oxo-3-pyrrolidin-1-ylpropanethioamide |
|---|---|
| PubChem CID | 6223236 |
| Molecular Formula | C13H14Cl2N4OS |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | (2Z)-2-[(2,5-dichlorophenyl)hydrazinylidene]-3-oxo-3-pyrrolidin-1-ylpropanethioamide |
| SMILES | NC(=S)/C(=N\Nc1cc(Cl)ccc1Cl)C(=O)N1CCCC1 |
| InChI | InChI=1S/C13H14Cl2N4OS/c14-8-3-4-9(15)10(7-8)17-18-11(12(16)21)13(20)19-5-1-2-6-19/h3-4,7,17H,1-2,5-6H2,(H2,16,21)/b18-11+ |
| InChIKey | JMMYNKQHMMBVIA-WOJGMQOQSA-N |
| XLogP | 2.67 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|