C15H20N4O2S — CID 6223223
(2Z)-2-[(3,4-dimethylphenyl)hydrazinylidene]-3-morpholin-4-yl-3-oxopropanethioamide (PubChem CID 6223223) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is (2Z)-2-[(3,4-dimethylphenyl)hydrazinylidene]-3-morpholin-4-yl-3-oxopropanethioamide.
| Compound Name | (2Z)-2-[(3,4-dimethylphenyl)hydrazinylidene]-3-morpholin-4-yl-3-oxopropanethioamide |
|---|---|
| PubChem CID | 6223223 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (2Z)-2-[(3,4-dimethylphenyl)hydrazinylidene]-3-morpholin-4-yl-3-oxopropanethioamide |
| SMILES | Cc1ccc(N/N=C(/C(=O)N2CCOCC2)C(N)=S)cc1C |
| InChI | InChI=1S/C15H20N4O2S/c1-10-3-4-12(9-11(10)2)17-18-13(14(16)22)15(20)19-5-7-21-8-6-19/h3-4,9,17H,5-8H2,1-2H3,(H2,16,22)/b18-13+ |
| InChIKey | UINNDWQPFFTWJJ-QGOAFFKASA-N |
| XLogP | 1.22 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|