C13H15NO4 — CID 62234991
ethyl 2-(2,3-dihydro-1-benzofuran-2-ylmethylamino)-2-oxoacetate (PubChem CID 62234991) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is ethyl 2-(2,3-dihydro-1-benzofuran-2-ylmethylamino)-2-oxoacetate.
| Compound Name | ethyl 2-(2,3-dihydro-1-benzofuran-2-ylmethylamino)-2-oxoacetate |
|---|---|
| PubChem CID | 62234991 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | ethyl 2-(2,3-dihydro-1-benzofuran-2-ylmethylamino)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C13H15NO4/c1-2-17-13(16)12(15)14-8-10-7-9-5-3-4-6-11(9)18-10/h3-6,10H,2,7-8H2,1H3,(H,14,15) |
| InChIKey | NSNBOZQPNCRAEC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|