C11H12N6O3S — CID 62236922
6-hydrazinyl-N-(3-sulfamoylphenyl)pyridazine-3-carboxamide (PubChem CID 62236922) has the molecular formula C11H12N6O3S and a molecular weight of 308.32 g/mol. Its IUPAC name is 6-hydrazinyl-N-(3-sulfamoylphenyl)pyridazine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-(3-sulfamoylphenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62236922 |
| Molecular Formula | C11H12N6O3S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 6-hydrazinyl-N-(3-sulfamoylphenyl)pyridazine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)Nc2cccc(S(N)(=O)=O)c2)nn1 |
| InChI | InChI=1S/C11H12N6O3S/c12-15-10-5-4-9(16-17-10)11(18)14-7-2-1-3-8(6-7)21(13,19)20/h1-6H,12H2,(H,14,18)(H,15,17)(H2,13,19,20) |
| InChIKey | KUDIQPQXOQDSQK-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|