C11H18N4O3 — CID 62237016
6-hydrazinyl-N-[2-(2-methoxyethoxy)ethyl]pyridine-2-carboxamide (PubChem CID 62237016) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 6-hydrazinyl-N-[2-(2-methoxyethoxy)ethyl]pyridine-2-carboxamide.
| Compound Name | 6-hydrazinyl-N-[2-(2-methoxyethoxy)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62237016 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 6-hydrazinyl-N-[2-(2-methoxyethoxy)ethyl]pyridine-2-carboxamide |
| SMILES | COCCOCCNC(=O)c1cccc(NN)n1 |
| InChI | InChI=1S/C11H18N4O3/c1-17-7-8-18-6-5-13-11(16)9-3-2-4-10(14-9)15-12/h2-4H,5-8,12H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | AYYDIFGFRDELOJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|