C17H15NO4 — CID 622395
(3-amino-1-benzofuran-2-yl)-(2,5-dimethoxyphenyl)methanone (PubChem CID 622395) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is (3-amino-1-benzofuran-2-yl)-(2,5-dimethoxyphenyl)methanone.
| Compound Name | (3-amino-1-benzofuran-2-yl)-(2,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 622395 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (3-amino-1-benzofuran-2-yl)-(2,5-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(OC)c(C(=O)c2oc3ccccc3c2N)c1 |
| InChI | InChI=1S/C17H15NO4/c1-20-10-7-8-13(21-2)12(9-10)16(19)17-15(18)11-5-3-4-6-14(11)22-17/h3-9H,18H2,1-2H3 |
| InChIKey | ARHUJNXFYFGBRX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |