About [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine
[4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine (PubChem CID 62245571) has the molecular formula C9H18N6S
and a molecular weight of 242.35 g/mol. Its IUPAC name is [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine.
Molecular Properties
| Compound Name | [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine |
| PubChem CID | 62245571 |
| Molecular Formula | C9H18N6S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine |
| SMILES | CN1CCCN(Cc2nnsc2NN)CC1 |
| InChI | InChI=1S/C9H18N6S/c1-14-3-2-4-15(6-5-14)7-8-9(11-10)16-13-12-8/h11H,2-7,10H2,1H3 |
| InChIKey | OKHYXIFOQNLIGU-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine?
The IUPAC name of [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine (CID 62245571) is [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine.
What is the SMILES notation for [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine?
The canonical SMILES for [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine is CN1CCCN(Cc2nnsc2NN)CC1.
What is the InChIKey of [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine?
The InChIKey is OKHYXIFOQNLIGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N6S/c1-14-3-2-4-15(6-5-14)7-8-9(11-10)16-13-12-8/h11H,2-7,10H2,1H3.
What are the key properties of [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine?
[4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine has a molecular weight of 242.35 g/mol, XLogP of -0.04, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine is sourced from PubChem (CID 62245571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).