C9H18N6S — CID 62245571
[4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine (PubChem CID 62245571) has the molecular formula C9H18N6S and a molecular weight of 242.35 g/mol. Its IUPAC name is [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine.
| Compound Name | [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine |
|---|---|
| PubChem CID | 62245571 |
| Molecular Formula | C9H18N6S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | [4-[(4-methyl-1,4-diazepan-1-yl)methyl]thiadiazol-5-yl]hydrazine |
| SMILES | CN1CCCN(Cc2nnsc2NN)CC1 |
| InChI | InChI=1S/C9H18N6S/c1-14-3-2-4-15(6-5-14)7-8-9(11-10)16-13-12-8/h11H,2-7,10H2,1H3 |
| InChIKey | OKHYXIFOQNLIGU-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|