C10H19N5S — CID 62244417
[4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine (PubChem CID 62244417) has the molecular formula C10H19N5S and a molecular weight of 241.36 g/mol. Its IUPAC name is [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine.
| Compound Name | [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine |
|---|---|
| PubChem CID | 62244417 |
| Molecular Formula | C10H19N5S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine |
| SMILES | CC1CC(C)CN(Cc2nnsc2NN)C1 |
| InChI | InChI=1S/C10H19N5S/c1-7-3-8(2)5-15(4-7)6-9-10(12-11)16-14-13-9/h7-8,12H,3-6,11H2,1-2H3 |
| InChIKey | QQHOSEDLUFNECF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|