About [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine
[4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine (PubChem CID 62244417) has the molecular formula C10H19N5S
and a molecular weight of 241.36 g/mol. Its IUPAC name is [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine.
Molecular Properties
| Compound Name | [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine |
| PubChem CID | 62244417 |
| Molecular Formula | C10H19N5S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine |
| SMILES | CC1CC(C)CN(Cc2nnsc2NN)C1 |
| InChI | InChI=1S/C10H19N5S/c1-7-3-8(2)5-15(4-7)6-9-10(12-11)16-14-13-9/h7-8,12H,3-6,11H2,1-2H3 |
| InChIKey | QQHOSEDLUFNECF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine?
The IUPAC name of [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine (CID 62244417) is [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine.
What is the SMILES notation for [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine?
The canonical SMILES for [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine is CC1CC(C)CN(Cc2nnsc2NN)C1.
What is the InChIKey of [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine?
The InChIKey is QQHOSEDLUFNECF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5S/c1-7-3-8(2)5-15(4-7)6-9-10(12-11)16-14-13-9/h7-8,12H,3-6,11H2,1-2H3.
What are the key properties of [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine?
[4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine has a molecular weight of 241.36 g/mol, XLogP of 1.30, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3,5-dimethylpiperidin-1-yl)methyl]thiadiazol-5-yl]hydrazine is sourced from PubChem (CID 62244417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).