C14H17ClN4OS — CID 62247454
3-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-6-hydrazinylpyridine-2-carboxamide (PubChem CID 62247454) has the molecular formula C14H17ClN4OS and a molecular weight of 324.84 g/mol. Its IUPAC name is 3-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-6-hydrazinylpyridine-2-carboxamide.
| Compound Name | 3-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-6-hydrazinylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 62247454 |
| Molecular Formula | C14H17ClN4OS |
| Molecular Weight | 324.84 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 3-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-6-hydrazinylpyridine-2-carboxamide |
| SMILES | Cc1cc(C(C)NC(=O)c2nc(NN)ccc2Cl)c(C)s1 |
| InChI | InChI=1S/C14H17ClN4OS/c1-7-6-10(9(3)21-7)8(2)17-14(20)13-11(15)4-5-12(18-13)19-16/h4-6,8H,16H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | LRMZMMZYRNEQNY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.84 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|