About (2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine
(2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine (PubChem CID 62250283) has the molecular formula C14H20N4S
and a molecular weight of 276.41 g/mol. Its IUPAC name is (2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine.
Molecular Properties
| Compound Name | (2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
| PubChem CID | 62250283 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
| SMILES | Cc1sc2nc(C3CCCCC3)nc(NN)c2c1C |
| InChI | InChI=1S/C14H20N4S/c1-8-9(2)19-14-11(8)13(18-15)16-12(17-14)10-6-4-3-5-7-10/h10H,3-7,15H2,1-2H3,(H,16,17,18) |
| InChIKey | KCROBVNEASDMIG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine?
The IUPAC name of (2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine (CID 62250283) is (2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine.
What is the SMILES notation for (2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine?
The canonical SMILES for (2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine is Cc1sc2nc(C3CCCCC3)nc(NN)c2c1C.
What is the InChIKey of (2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine?
The InChIKey is KCROBVNEASDMIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4S/c1-8-9(2)19-14-11(8)13(18-15)16-12(17-14)10-6-4-3-5-7-10/h10H,3-7,15H2,1-2H3,(H,16,17,18).
What are the key properties of (2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine?
(2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine has a molecular weight of 276.41 g/mol, XLogP of 3.64, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine is sourced from PubChem (CID 62250283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).