C15H22N4S — CID 65399665
(2-cycloheptyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine (PubChem CID 65399665) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is (2-cycloheptyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine.
| Compound Name | (2-cycloheptyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 65399665 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (2-cycloheptyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
| SMILES | Cc1sc2nc(C3CCCCCC3)nc(NN)c2c1C |
| InChI | InChI=1S/C15H22N4S/c1-9-10(2)20-15-12(9)14(19-16)17-13(18-15)11-7-5-3-4-6-8-11/h11H,3-8,16H2,1-2H3,(H,17,18,19) |
| InChIKey | BIQAPTMCHGTDBI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|