C9H13N3O3S — CID 62252511
2-[(2-hydrazinyl-5-nitrophenyl)methylsulfanyl]ethanol (PubChem CID 62252511) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-[(2-hydrazinyl-5-nitrophenyl)methylsulfanyl]ethanol.
| Compound Name | 2-[(2-hydrazinyl-5-nitrophenyl)methylsulfanyl]ethanol |
|---|---|
| PubChem CID | 62252511 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-[(2-hydrazinyl-5-nitrophenyl)methylsulfanyl]ethanol |
| SMILES | NNc1ccc([N+](=O)[O-])cc1CSCCO |
| InChI | InChI=1S/C9H13N3O3S/c10-11-9-2-1-8(12(14)15)5-7(9)6-16-4-3-13/h1-2,5,11,13H,3-4,6,10H2 |
| InChIKey | OMSOTSZPDUPFMC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|