C10H11N5O3S — CID 62245269
[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-4-nitrophenyl]hydrazine (PubChem CID 62245269) has the molecular formula C10H11N5O3S and a molecular weight of 281.30 g/mol. Its IUPAC name is [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-4-nitrophenyl]hydrazine.
| Compound Name | [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-4-nitrophenyl]hydrazine |
|---|---|
| PubChem CID | 62245269 |
| Molecular Formula | C10H11N5O3S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-4-nitrophenyl]hydrazine |
| SMILES | Cc1nnc(SCc2cc([N+](=O)[O-])ccc2NN)o1 |
| InChI | InChI=1S/C10H11N5O3S/c1-6-13-14-10(18-6)19-5-7-4-8(15(16)17)2-3-9(7)12-11/h2-4,12H,5,11H2,1H3 |
| InChIKey | MIPUHLJMTBFQMD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|