C11H13N7O2S — CID 62251379
2-[(2-hydrazinyl-5-nitrophenyl)methylsulfanyl]pyrimidine-4,6-diamine (PubChem CID 62251379) has the molecular formula C11H13N7O2S and a molecular weight of 307.34 g/mol. Its IUPAC name is 2-[(2-hydrazinyl-5-nitrophenyl)methylsulfanyl]pyrimidine-4,6-diamine.
| Compound Name | 2-[(2-hydrazinyl-5-nitrophenyl)methylsulfanyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 62251379 |
| Molecular Formula | C11H13N7O2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-[(2-hydrazinyl-5-nitrophenyl)methylsulfanyl]pyrimidine-4,6-diamine |
| SMILES | NNc1ccc([N+](=O)[O-])cc1CSc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C11H13N7O2S/c12-9-4-10(13)16-11(15-9)21-5-6-3-7(18(19)20)1-2-8(6)17-14/h1-4,17H,5,14H2,(H4,12,13,15,16) |
| InChIKey | OJAJYNRPLYLYBC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 159.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|