C14H19N3O — CID 62264641
2-(7-amino-3,4-dihydro-2H-quinolin-1-yl)-N-cyclopropylacetamide (PubChem CID 62264641) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-(7-amino-3,4-dihydro-2H-quinolin-1-yl)-N-cyclopropylacetamide.
| Compound Name | 2-(7-amino-3,4-dihydro-2H-quinolin-1-yl)-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 62264641 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-(7-amino-3,4-dihydro-2H-quinolin-1-yl)-N-cyclopropylacetamide |
| SMILES | Nc1ccc2c(c1)N(CC(=O)NC1CC1)CCC2 |
| InChI | InChI=1S/C14H19N3O/c15-11-4-3-10-2-1-7-17(13(10)8-11)9-14(18)16-12-5-6-12/h3-4,8,12H,1-2,5-7,9,15H2,(H,16,18) |
| InChIKey | TUSKVEQQWZDUGS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|