C16H25N3O2 — CID 62264814
2-(7-amino-3,4-dihydro-2H-quinolin-1-yl)-N-(3-methoxypropyl)propanamide (PubChem CID 62264814) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-(7-amino-3,4-dihydro-2H-quinolin-1-yl)-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-(7-amino-3,4-dihydro-2H-quinolin-1-yl)-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 62264814 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-(7-amino-3,4-dihydro-2H-quinolin-1-yl)-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C(C)N1CCCc2ccc(N)cc21 |
| InChI | InChI=1S/C16H25N3O2/c1-12(16(20)18-8-4-10-21-2)19-9-3-5-13-6-7-14(17)11-15(13)19/h6-7,11-12H,3-5,8-10,17H2,1-2H3,(H,18,20) |
| InChIKey | MUWIMJPEMYVJGH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|