C16H36N2O — CID 62271517
2-[[2-ethyl-2-[(2-methylpropylamino)methyl]butyl]-propan-2-ylamino]ethanol (PubChem CID 62271517) has the molecular formula C16H36N2O and a molecular weight of 272.48 g/mol. Its IUPAC name is 2-[[2-ethyl-2-[(2-methylpropylamino)methyl]butyl]-propan-2-ylamino]ethanol.
| Compound Name | 2-[[2-ethyl-2-[(2-methylpropylamino)methyl]butyl]-propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 62271517 |
| Molecular Formula | C16H36N2O |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.28 |
| IUPAC Name | 2-[[2-ethyl-2-[(2-methylpropylamino)methyl]butyl]-propan-2-ylamino]ethanol |
| SMILES | CCC(CC)(CNCC(C)C)CN(CCO)C(C)C |
| InChI | InChI=1S/C16H36N2O/c1-7-16(8-2,12-17-11-14(3)4)13-18(9-10-19)15(5)6/h14-15,17,19H,7-13H2,1-6H3 |
| InChIKey | WEPQQKWDAMCBKO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |