C15H34N2O2 — CID 55056371
2-[[2-ethyl-2-[(2-methylpropylamino)methyl]butyl]-(2-hydroxyethyl)amino]ethanol (PubChem CID 55056371) has the molecular formula C15H34N2O2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 2-[[2-ethyl-2-[(2-methylpropylamino)methyl]butyl]-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[[2-ethyl-2-[(2-methylpropylamino)methyl]butyl]-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 55056371 |
| Molecular Formula | C15H34N2O2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.26 |
| IUPAC Name | 2-[[2-ethyl-2-[(2-methylpropylamino)methyl]butyl]-(2-hydroxyethyl)amino]ethanol |
| SMILES | CCC(CC)(CNCC(C)C)CN(CCO)CCO |
| InChI | InChI=1S/C15H34N2O2/c1-5-15(6-2,12-16-11-14(3)4)13-17(7-9-18)8-10-19/h14,16,18-19H,5-13H2,1-4H3 |
| InChIKey | WNSCHTMNRRHJNB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |