C12H23NO — CID 62277014
3-[cyclopropylmethyl(propan-2-yl)amino]-2,2-dimethylpropanal (PubChem CID 62277014) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 3-[cyclopropylmethyl(propan-2-yl)amino]-2,2-dimethylpropanal.
| Compound Name | 3-[cyclopropylmethyl(propan-2-yl)amino]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 62277014 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 3-[cyclopropylmethyl(propan-2-yl)amino]-2,2-dimethylpropanal |
| SMILES | CC(C)N(CC1CC1)CC(C)(C)C=O |
| InChI | InChI=1S/C12H23NO/c1-10(2)13(7-11-5-6-11)8-12(3,4)9-14/h9-11H,5-8H2,1-4H3 |
| InChIKey | PGCACGPPNMXLJF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|