C15H24BrN3O — CID 62293675
5-bromo-N-(1-cyclopropylethyl)-N-(2-methoxyethyl)-3-(methylaminomethyl)pyridin-2-amine (PubChem CID 62293675) has the molecular formula C15H24BrN3O and a molecular weight of 342.28 g/mol. Its IUPAC name is 5-bromo-N-(1-cyclopropylethyl)-N-(2-methoxyethyl)-3-(methylaminomethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(1-cyclopropylethyl)-N-(2-methoxyethyl)-3-(methylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 62293675 |
| Molecular Formula | C15H24BrN3O |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 5-bromo-N-(1-cyclopropylethyl)-N-(2-methoxyethyl)-3-(methylaminomethyl)pyridin-2-amine |
| SMILES | CNCc1cc(Br)cnc1N(CCOC)C(C)C1CC1 |
| InChI | InChI=1S/C15H24BrN3O/c1-11(12-4-5-12)19(6-7-20-3)15-13(9-17-2)8-14(16)10-18-15/h8,10-12,17H,4-7,9H2,1-3H3 |
| InChIKey | QRLLGTWNHFUMAU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |