About [5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine
[5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine (PubChem CID 62298416) has the molecular formula C13H16ClN5S
and a molecular weight of 309.83 g/mol. Its IUPAC name is [5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine |
| PubChem CID | 62298416 |
| Molecular Formula | C13H16ClN5S |
| Molecular Weight | 309.83 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | [5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine |
| SMILES | NCc1cnc(N2CCN(c3nccs3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C13H16ClN5S/c14-11-7-10(8-15)9-17-12(11)18-2-4-19(5-3-18)13-16-1-6-20-13/h1,6-7,9H,2-5,8,15H2 |
| InChIKey | KWZGMXVHTLELBA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.83 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine?
The IUPAC name of [5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine (CID 62298416) is [5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine.
What is the SMILES notation for [5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine?
The canonical SMILES for [5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine is NCc1cnc(N2CCN(c3nccs3)CC2)c(Cl)c1.
What is the InChIKey of [5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine?
The InChIKey is KWZGMXVHTLELBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN5S/c14-11-7-10(8-15)9-17-12(11)18-2-4-19(5-3-18)13-16-1-6-20-13/h1,6-7,9H,2-5,8,15H2.
What are the key properties of [5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine?
[5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine has a molecular weight of 309.83 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-chloro-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-pyridinyl]methanamine is sourced from PubChem (CID 62298416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).