C14H20N4S — CID 62299111
4-(aminomethyl)-N-methyl-2-propan-2-yl-N-(thiophen-2-ylmethyl)pyrimidin-5-amine (PubChem CID 62299111) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is 4-(aminomethyl)-N-methyl-2-propan-2-yl-N-(thiophen-2-ylmethyl)pyrimidin-5-amine.
| Compound Name | 4-(aminomethyl)-N-methyl-2-propan-2-yl-N-(thiophen-2-ylmethyl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 62299111 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-(aminomethyl)-N-methyl-2-propan-2-yl-N-(thiophen-2-ylmethyl)pyrimidin-5-amine |
| SMILES | CC(C)c1ncc(N(C)Cc2cccs2)c(CN)n1 |
| InChI | InChI=1S/C14H20N4S/c1-10(2)14-16-8-13(12(7-15)17-14)18(3)9-11-5-4-6-19-11/h4-6,8,10H,7,9,15H2,1-3H3 |
| InChIKey | RWOVXNDHAODESO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |