C16H22ClN3S — CID 62087440
4-(chloromethyl)-N,2-di(propan-2-yl)-N-(thiophen-2-ylmethyl)pyrimidin-5-amine (PubChem CID 62087440) has the molecular formula C16H22ClN3S and a molecular weight of 323.89 g/mol. Its IUPAC name is 4-(chloromethyl)-N,2-di(propan-2-yl)-N-(thiophen-2-ylmethyl)pyrimidin-5-amine.
| Compound Name | 4-(chloromethyl)-N,2-di(propan-2-yl)-N-(thiophen-2-ylmethyl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 62087440 |
| Molecular Formula | C16H22ClN3S |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 4-(chloromethyl)-N,2-di(propan-2-yl)-N-(thiophen-2-ylmethyl)pyrimidin-5-amine |
| SMILES | CC(C)c1ncc(N(Cc2cccs2)C(C)C)c(CCl)n1 |
| InChI | InChI=1S/C16H22ClN3S/c1-11(2)16-18-9-15(14(8-17)19-16)20(12(3)4)10-13-6-5-7-21-13/h5-7,9,11-12H,8,10H2,1-4H3 |
| InChIKey | KMYPTHREDBYVNG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|