C16H20ClN3S — CID 62086549
4-(chloromethyl)-N-cyclopropyl-2-propan-2-yl-N-(thiophen-3-ylmethyl)pyrimidin-5-amine (PubChem CID 62086549) has the molecular formula C16H20ClN3S and a molecular weight of 321.88 g/mol. Its IUPAC name is 4-(chloromethyl)-N-cyclopropyl-2-propan-2-yl-N-(thiophen-3-ylmethyl)pyrimidin-5-amine.
| Compound Name | 4-(chloromethyl)-N-cyclopropyl-2-propan-2-yl-N-(thiophen-3-ylmethyl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 62086549 |
| Molecular Formula | C16H20ClN3S |
| Molecular Weight | 321.88 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-(chloromethyl)-N-cyclopropyl-2-propan-2-yl-N-(thiophen-3-ylmethyl)pyrimidin-5-amine |
| SMILES | CC(C)c1ncc(N(Cc2ccsc2)C2CC2)c(CCl)n1 |
| InChI | InChI=1S/C16H20ClN3S/c1-11(2)16-18-8-15(14(7-17)19-16)20(13-3-4-13)9-12-5-6-21-10-12/h5-6,8,10-11,13H,3-4,7,9H2,1-2H3 |
| InChIKey | DKKMXQCGSJVXFU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.88 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|