About 2-(aminomethyl)-N,N-dibutylpyridin-4-amine
2-(aminomethyl)-N,N-dibutylpyridin-4-amine (PubChem CID 62300849) has the molecular formula C14H25N3
and a molecular weight of 235.38 g/mol. Its IUPAC name is 2-(aminomethyl)-N,N-dibutylpyridin-4-amine.
Molecular Properties
| Compound Name | 2-(aminomethyl)-N,N-dibutylpyridin-4-amine |
| PubChem CID | 62300849 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 2-(aminomethyl)-N,N-dibutylpyridin-4-amine |
| SMILES | CCCCN(CCCC)c1ccnc(CN)c1 |
| InChI | InChI=1S/C14H25N3/c1-3-5-9-17(10-6-4-2)14-7-8-16-13(11-14)12-15/h7-8,11H,3-6,9-10,12,15H2,1-2H3 |
| InChIKey | NFYZAOMYLDTRDG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(aminomethyl)-N,N-dibutylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-N,N-dibutylpyridin-4-amine?
The IUPAC name of 2-(aminomethyl)-N,N-dibutylpyridin-4-amine (CID 62300849) is 2-(aminomethyl)-N,N-dibutylpyridin-4-amine.
What is the SMILES notation for 2-(aminomethyl)-N,N-dibutylpyridin-4-amine?
The canonical SMILES for 2-(aminomethyl)-N,N-dibutylpyridin-4-amine is CCCCN(CCCC)c1ccnc(CN)c1.
What is the InChIKey of 2-(aminomethyl)-N,N-dibutylpyridin-4-amine?
The InChIKey is NFYZAOMYLDTRDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3/c1-3-5-9-17(10-6-4-2)14-7-8-16-13(11-14)12-15/h7-8,11H,3-6,9-10,12,15H2,1-2H3.
What are the key properties of 2-(aminomethyl)-N,N-dibutylpyridin-4-amine?
2-(aminomethyl)-N,N-dibutylpyridin-4-amine has a molecular weight of 235.38 g/mol, XLogP of 2.95, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-N,N-dibutylpyridin-4-amine is sourced from PubChem (CID 62300849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).