C13H15N3OS — CID 62301940
4-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methylamino]benzenecarbothioamide (PubChem CID 62301940) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 4-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methylamino]benzenecarbothioamide.
| Compound Name | 4-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 62301940 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methylamino]benzenecarbothioamide |
| SMILES | Cc1ccc(C(N)=S)c(NCc2cc(C)on2)c1 |
| InChI | InChI=1S/C13H15N3OS/c1-8-3-4-11(13(14)18)12(5-8)15-7-10-6-9(2)17-16-10/h3-6,15H,7H2,1-2H3,(H2,14,18) |
| InChIKey | ZMVUCSZBRQOZNO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|