C25H20N2O6 — CID 6230633
(E)-2,3-dihydro-1,4-benzodioxin-6-yl-[2-(3-hydroxyphenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]methanolate (PubChem CID 6230633) has the molecular formula C25H20N2O6 and a molecular weight of 444.44 g/mol. Its IUPAC name is (E)-2,3-dihydro-1,4-benzodioxin-6-yl-[2-(3-hydroxyphenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]methanolate.
| Compound Name | (E)-2,3-dihydro-1,4-benzodioxin-6-yl-[2-(3-hydroxyphenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 6230633 |
| Molecular Formula | C25H20N2O6 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (E)-2,3-dihydro-1,4-benzodioxin-6-yl-[2-(3-hydroxyphenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]methanolate |
| SMILES | O=C1C(=O)N(Cc2ccc[nH+]c2)C(c2cccc(O)c2)/C1=C(\[O-])c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H20N2O6/c28-18-5-1-4-16(11-18)22-21(23(29)17-6-7-19-20(12-17)33-10-9-32-19)24(30)25(31)27(22)14-15-3-2-8-26-13-15/h1-8,11-13,22,28-29H,9-10,14H2/b23-21+ |
| InChIKey | DNFWFYBJXFVCDM-XTQSDGFTSA-N |
| XLogP | 1.40 |
| TPSA | 113.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|