C11H16N4O — CID 62312919
[2-(oxolan-3-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine (PubChem CID 62312919) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is [2-(oxolan-3-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(oxolan-3-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62312919 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | [2-(oxolan-3-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(C2CCOC2)nc2c1CCC2 |
| InChI | InChI=1S/C11H16N4O/c12-15-11-8-2-1-3-9(8)13-10(14-11)7-4-5-16-6-7/h7H,1-6,12H2,(H,13,14,15) |
| InChIKey | IBHLSJFJVBHKQV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|