C12H13N3 — CID 62313145
3-[(2-iminopyrrolidin-1-yl)methyl]benzonitrile (PubChem CID 62313145) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 3-[(2-iminopyrrolidin-1-yl)methyl]benzonitrile.
| Compound Name | 3-[(2-iminopyrrolidin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 62313145 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 3-[(2-iminopyrrolidin-1-yl)methyl]benzonitrile |
| SMILES | [H]/N=C1\CCCN1Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C12H13N3/c13-8-10-3-1-4-11(7-10)9-15-6-2-5-12(15)14/h1,3-4,7,14H,2,5-6,9H2/b14-12+ |
| InChIKey | XAFNJJJOTZBICR-WYMLVPIESA-N |
| XLogP | 2.13 |
| TPSA | 50.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|