C15H18F3NO2 — CID 62315278
2-cyclohexyl-2-[2-(trifluoromethyl)anilino]acetic acid (PubChem CID 62315278) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-cyclohexyl-2-[2-(trifluoromethyl)anilino]acetic acid.
| Compound Name | 2-cyclohexyl-2-[2-(trifluoromethyl)anilino]acetic acid |
|---|---|
| PubChem CID | 62315278 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-cyclohexyl-2-[2-(trifluoromethyl)anilino]acetic acid |
| SMILES | O=C(O)C(Nc1ccccc1C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C15H18F3NO2/c16-15(17,18)11-8-4-5-9-12(11)19-13(14(20)21)10-6-2-1-3-7-10/h4-5,8-10,13,19H,1-3,6-7H2,(H,20,21) |
| InChIKey | SASXASKPLGEZFJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |