C13H10ClF3N2O2 — CID 62318818
5-chloro-3-(methoxymethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbaldehyde (PubChem CID 62318818) has the molecular formula C13H10ClF3N2O2 and a molecular weight of 318.68 g/mol. Its IUPAC name is 5-chloro-3-(methoxymethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbaldehyde.
| Compound Name | 5-chloro-3-(methoxymethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 62318818 |
| Molecular Formula | C13H10ClF3N2O2 |
| Molecular Weight | 318.68 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 5-chloro-3-(methoxymethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbaldehyde |
| SMILES | COCc1nn(-c2cccc(C(F)(F)F)c2)c(Cl)c1C=O |
| InChI | InChI=1S/C13H10ClF3N2O2/c1-21-7-11-10(6-20)12(14)19(18-11)9-4-2-3-8(5-9)13(15,16)17/h2-6H,7H2,1H3 |
| InChIKey | KUJCQILRWCSURY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.68 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|