C10H17ClN4O2S — CID 62320919
N-(4-aminocyclohexyl)-5-chloro-1-methylimidazole-4-sulfonamide (PubChem CID 62320919) has the molecular formula C10H17ClN4O2S and a molecular weight of 292.79 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-5-chloro-1-methylimidazole-4-sulfonamide.
| Compound Name | N-(4-aminocyclohexyl)-5-chloro-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 62320919 |
| Molecular Formula | C10H17ClN4O2S |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | N-(4-aminocyclohexyl)-5-chloro-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NC2CCC(N)CC2)c1Cl |
| InChI | InChI=1S/C10H17ClN4O2S/c1-15-6-13-10(9(15)11)18(16,17)14-8-4-2-7(12)3-5-8/h6-8,14H,2-5,12H2,1H3 |
| InChIKey | SOIMTVFFAPFWED-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |