C12H16ClN3 — CID 62327428
2-(5-chloro-1-methylbenzimidazol-2-yl)-N-ethylethanamine (PubChem CID 62327428) has the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. Its IUPAC name is 2-(5-chloro-1-methylbenzimidazol-2-yl)-N-ethylethanamine.
| Compound Name | 2-(5-chloro-1-methylbenzimidazol-2-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 62327428 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-(5-chloro-1-methylbenzimidazol-2-yl)-N-ethylethanamine |
| SMILES | CCNCCc1nc2cc(Cl)ccc2n1C |
| InChI | InChI=1S/C12H16ClN3/c1-3-14-7-6-12-15-10-8-9(13)4-5-11(10)16(12)2/h4-5,8,14H,3,6-7H2,1-2H3 |
| InChIKey | QWUXFQWTNRAWJZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|