C18H23ClN4O — CID 75425810
N-[2-(5-chloro-1-methylbenzimidazol-2-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 75425810) has the molecular formula C18H23ClN4O and a molecular weight of 346.86 g/mol. Its IUPAC name is N-[2-(5-chloro-1-methylbenzimidazol-2-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | N-[2-(5-chloro-1-methylbenzimidazol-2-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 75425810 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[2-(5-chloro-1-methylbenzimidazol-2-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | Cn1c(CCNC(=O)N2CC3CCCC3C2)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H23ClN4O/c1-22-16-6-5-14(19)9-15(16)21-17(22)7-8-20-18(24)23-10-12-3-2-4-13(12)11-23/h5-6,9,12-13H,2-4,7-8,10-11H2,1H3,(H,20,24) |
| InChIKey | WOKCZBIAXDBANC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |