C17H25ClN4O — CID 86779822
(2S)-N-[2-(5-chloro-1-methylbenzimidazol-2-yl)ethyl]-2-(dimethylamino)-3-methylbutanamide (PubChem CID 86779822) has the molecular formula C17H25ClN4O and a molecular weight of 336.87 g/mol. Its IUPAC name is (2S)-N-[2-(5-chloro-1-methylbenzimidazol-2-yl)ethyl]-2-(dimethylamino)-3-methylbutanamide.
| Compound Name | (2S)-N-[2-(5-chloro-1-methylbenzimidazol-2-yl)ethyl]-2-(dimethylamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 86779822 |
| Molecular Formula | C17H25ClN4O |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (2S)-N-[2-(5-chloro-1-methylbenzimidazol-2-yl)ethyl]-2-(dimethylamino)-3-methylbutanamide |
| SMILES | CC(C)[C@@H](C(=O)NCCc1nc2cc(Cl)ccc2n1C)N(C)C |
| InChI | InChI=1S/C17H25ClN4O/c1-11(2)16(21(3)4)17(23)19-9-8-15-20-13-10-12(18)6-7-14(13)22(15)5/h6-7,10-11,16H,8-9H2,1-5H3,(H,19,23)/t16-/m0/s1 |
| InChIKey | YZSXLIIWSFUBHU-INIZCTEOSA-N |
| XLogP | 2.47 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |