C17H21ClN4O2 — CID 84587432
1-[2-(5-chloro-1-methylbenzimidazol-2-yl)ethyl]-3-(7-oxabicyclo[2.2.1]heptan-2-yl)urea (PubChem CID 84587432) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 1-[2-(5-chloro-1-methylbenzimidazol-2-yl)ethyl]-3-(7-oxabicyclo[2.2.1]heptan-2-yl)urea.
| Compound Name | 1-[2-(5-chloro-1-methylbenzimidazol-2-yl)ethyl]-3-(7-oxabicyclo[2.2.1]heptan-2-yl)urea |
|---|---|
| PubChem CID | 84587432 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[2-(5-chloro-1-methylbenzimidazol-2-yl)ethyl]-3-(7-oxabicyclo[2.2.1]heptan-2-yl)urea |
| SMILES | Cn1c(CCNC(=O)NC2CC3CCC2O3)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H21ClN4O2/c1-22-14-4-2-10(18)8-12(14)20-16(22)6-7-19-17(23)21-13-9-11-3-5-15(13)24-11/h2,4,8,11,13,15H,3,5-7,9H2,1H3,(H2,19,21,23) |
| InChIKey | CZFQPGZRUOEVOP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |