C9H21IO4Si2 — CID 623529
[[iodomethyl(dimethyl)silyl]oxy-dimethylsilyl]methyl 2-hydroxypropanoate (PubChem CID 623529) has the molecular formula C9H21IO4Si2 and a molecular weight of 376.34 g/mol. Its IUPAC name is [[iodomethyl(dimethyl)silyl]oxy-dimethylsilyl]methyl 2-hydroxypropanoate.
| Compound Name | [[iodomethyl(dimethyl)silyl]oxy-dimethylsilyl]methyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 623529 |
| Molecular Formula | C9H21IO4Si2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | [[iodomethyl(dimethyl)silyl]oxy-dimethylsilyl]methyl 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OC[Si](C)(C)O[Si](C)(C)CI |
| InChI | InChI=1S/C9H21IO4Si2/c1-8(11)9(12)13-7-16(4,5)14-15(2,3)6-10/h8,11H,6-7H2,1-5H3 |
| InChIKey | LDUVCMGTZDVKON-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|