C12H15Cl2N — CID 62353383
3-(2,5-dichlorophenyl)-2,3-dimethylpyrrolidine (PubChem CID 62353383) has the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-2,3-dimethylpyrrolidine.
| Compound Name | 3-(2,5-dichlorophenyl)-2,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 62353383 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-2,3-dimethylpyrrolidine |
| SMILES | CC1NCCC1(C)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H15Cl2N/c1-8-12(2,5-6-15-8)10-7-9(13)3-4-11(10)14/h3-4,7-8,15H,5-6H2,1-2H3 |
| InChIKey | ILWUUVMPOJSDHC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |