C10H24N4 — CID 62358805
2-[5-(diethylamino)pentan-2-yl]guanidine (PubChem CID 62358805) has the molecular formula C10H24N4 and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-[5-(diethylamino)pentan-2-yl]guanidine.
| Compound Name | 2-[5-(diethylamino)pentan-2-yl]guanidine |
|---|---|
| PubChem CID | 62358805 |
| Molecular Formula | C10H24N4 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.20 |
| IUPAC Name | 2-[5-(diethylamino)pentan-2-yl]guanidine |
| SMILES | CCN(CC)CCCC(C)N=C(N)N |
| InChI | InChI=1S/C10H24N4/c1-4-14(5-2)8-6-7-9(3)13-10(11)12/h9H,4-8H2,1-3H3,(H4,11,12,13) |
| InChIKey | LQWXTVOWKIISDE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|