C14H21ClN4 — CID 62361052
4-(2-chlorophenyl)-N'-propylpiperazine-1-carboximidamide (PubChem CID 62361052) has the molecular formula C14H21ClN4 and a molecular weight of 280.80 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N'-propylpiperazine-1-carboximidamide.
| Compound Name | 4-(2-chlorophenyl)-N'-propylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 62361052 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 4-(2-chlorophenyl)-N'-propylpiperazine-1-carboximidamide |
| SMILES | CCC/N=C(\N)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C14H21ClN4/c1-2-7-17-14(16)19-10-8-18(9-11-19)13-6-4-3-5-12(13)15/h3-6H,2,7-11H2,1H3,(H2,16,17) |
| InChIKey | QOXVBVUENVMSKG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|