C13H13Cl2NO2 — CID 62366157
methyl 2-(2,5-dichlorophenyl)-2-(prop-2-ynylamino)propanoate (PubChem CID 62366157) has the molecular formula C13H13Cl2NO2 and a molecular weight of 286.16 g/mol. Its IUPAC name is methyl 2-(2,5-dichlorophenyl)-2-(prop-2-ynylamino)propanoate.
| Compound Name | methyl 2-(2,5-dichlorophenyl)-2-(prop-2-ynylamino)propanoate |
|---|---|
| PubChem CID | 62366157 |
| Molecular Formula | C13H13Cl2NO2 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | methyl 2-(2,5-dichlorophenyl)-2-(prop-2-ynylamino)propanoate |
| SMILES | C#CCNC(C)(C(=O)OC)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H13Cl2NO2/c1-4-7-16-13(2,12(17)18-3)10-8-9(14)5-6-11(10)15/h1,5-6,8,16H,7H2,2-3H3 |
| InChIKey | VPYMYTJGJRSYHQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|