C14H12N2O3S — CID 62390068
5-amino-2-benzyl-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 62390068) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is 5-amino-2-benzyl-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 5-amino-2-benzyl-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 62390068 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 5-amino-2-benzyl-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | Nc1ccc2c(c1)C(=O)N(Cc1ccccc1)S2(=O)=O |
| InChI | InChI=1S/C14H12N2O3S/c15-11-6-7-13-12(8-11)14(17)16(20(13,18)19)9-10-4-2-1-3-5-10/h1-8H,9,15H2 |
| InChIKey | JQXMZIKFARBGHD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|