C15H29F3N2O — CID 62392201
N-[[4-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]propan-1-amine (PubChem CID 62392201) has the molecular formula C15H29F3N2O and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[[4-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62392201 |
| Molecular Formula | C15H29F3N2O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | N-[[4-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1(CN(CCC)CC(F)(F)F)CCOCC1 |
| InChI | InChI=1S/C15H29F3N2O/c1-3-7-19-11-14(5-9-21-10-6-14)12-20(8-4-2)13-15(16,17)18/h19H,3-13H2,1-2H3 |
| InChIKey | AGHWYXWEBQJEST-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|