C14H12BrClN4O — CID 62394063
2-[[4-(2-bromoethyl)triazol-1-yl]methyl]-5-(4-chlorophenyl)-1,3-oxazole (PubChem CID 62394063) has the molecular formula C14H12BrClN4O and a molecular weight of 367.63 g/mol. Its IUPAC name is 2-[[4-(2-bromoethyl)triazol-1-yl]methyl]-5-(4-chlorophenyl)-1,3-oxazole.
| Compound Name | 2-[[4-(2-bromoethyl)triazol-1-yl]methyl]-5-(4-chlorophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 62394063 |
| Molecular Formula | C14H12BrClN4O |
| Molecular Weight | 367.63 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 2-[[4-(2-bromoethyl)triazol-1-yl]methyl]-5-(4-chlorophenyl)-1,3-oxazole |
| SMILES | Clc1ccc(-c2cnc(Cn3cc(CCBr)nn3)o2)cc1 |
| InChI | InChI=1S/C14H12BrClN4O/c15-6-5-12-8-20(19-18-12)9-14-17-7-13(21-14)10-1-3-11(16)4-2-10/h1-4,7-8H,5-6,9H2 |
| InChIKey | FEDNJURJVAPEQY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.63 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|