C12H11BrN4S2 — CID 62395485
4-[[4-(2-bromoethyl)triazol-1-yl]methyl]-2-thiophen-3-yl-1,3-thiazole (PubChem CID 62395485) has the molecular formula C12H11BrN4S2 and a molecular weight of 355.29 g/mol. Its IUPAC name is 4-[[4-(2-bromoethyl)triazol-1-yl]methyl]-2-thiophen-3-yl-1,3-thiazole.
| Compound Name | 4-[[4-(2-bromoethyl)triazol-1-yl]methyl]-2-thiophen-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 62395485 |
| Molecular Formula | C12H11BrN4S2 |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 4-[[4-(2-bromoethyl)triazol-1-yl]methyl]-2-thiophen-3-yl-1,3-thiazole |
| SMILES | BrCCc1cn(Cc2csc(-c3ccsc3)n2)nn1 |
| InChI | InChI=1S/C12H11BrN4S2/c13-3-1-10-5-17(16-15-10)6-11-8-19-12(14-11)9-2-4-18-7-9/h2,4-5,7-8H,1,3,6H2 |
| InChIKey | SBQPOVWKQNGCFC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|