C12H9BrClN5O — CID 62399332
2-(2-bromophenyl)-5-[[4-(chloromethyl)triazol-1-yl]methyl]-1,3,4-oxadiazole (PubChem CID 62399332) has the molecular formula C12H9BrClN5O and a molecular weight of 354.60 g/mol. Its IUPAC name is 2-(2-bromophenyl)-5-[[4-(chloromethyl)triazol-1-yl]methyl]-1,3,4-oxadiazole.
| Compound Name | 2-(2-bromophenyl)-5-[[4-(chloromethyl)triazol-1-yl]methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 62399332 |
| Molecular Formula | C12H9BrClN5O |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 2-(2-bromophenyl)-5-[[4-(chloromethyl)triazol-1-yl]methyl]-1,3,4-oxadiazole |
| SMILES | ClCc1cn(Cc2nnc(-c3ccccc3Br)o2)nn1 |
| InChI | InChI=1S/C12H9BrClN5O/c13-10-4-2-1-3-9(10)12-17-16-11(20-12)7-19-6-8(5-14)15-18-19/h1-4,6H,5,7H2 |
| InChIKey | NIAZXFMRQOSORH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|